C24H32O7 — CID 139587602
[(1S,4E,9S,11Z,14R)-9-hydroxy-1,4,11-trimethyl-7,17-dioxo-15-propan-2-yl-6,18-dioxatricyclo[12.4.0.05,9]octadeca-4,11,15-trien-10-yl] acetate (PubChem CID 139587602) has the molecular formula C24H32O7 and a molecular weight of 432.51 g/mol. Its IUPAC name is [(1S,4E,9S,11Z,14R)-9-hydroxy-1,4,11-trimethyl-7,17-dioxo-15-propan-2-yl-6,18-dioxatricyclo[12.4.0.05,9]octadeca-4,11,15-trien-10-yl] acetate.
| Compound Name | [(1S,4E,9S,11Z,14R)-9-hydroxy-1,4,11-trimethyl-7,17-dioxo-15-propan-2-yl-6,18-dioxatricyclo[12.4.0.05,9]octadeca-4,11,15-trien-10-yl] acetate |
|---|---|
| PubChem CID | 139587602 |
| Molecular Formula | C24H32O7 |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | [(1S,4E,9S,11Z,14R)-9-hydroxy-1,4,11-trimethyl-7,17-dioxo-15-propan-2-yl-6,18-dioxatricyclo[12.4.0.05,9]octadeca-4,11,15-trien-10-yl] acetate |
| SMILES | CC(=O)OC1/C(C)=C\C[C@@H]2C(C(C)C)=CC(=O)O[C@@]2(C)CC/C(C)=C2/OC(=O)C[C@@]21O |
| InChI | InChI=1S/C24H32O7/c1-13(2)17-11-19(26)31-23(6)10-9-15(4)22-24(28,12-20(27)30-22)21(29-16(5)25)14(3)7-8-18(17)23/h7,11,13,18,21,28H,8-10,12H2,1-6H3/b14-7-,22-15+/t18-,21?,23+,24+/m1/s1 |
| InChIKey | JRKKTRKUMGTMCG-BMKBJXAWSA-N |
| XLogP | 3.51 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|