C22H34O3 — CID 25147132
[(3S,3aS,5aS,8S,10aR,10bS)-8-hydroxy-3a,5a,8-trimethyl-1-propan-2-yl-4,5,9,10,10a,10b-hexahydro-3H-cyclohepta[e]inden-3-yl] acetate (PubChem CID 25147132) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is [(3S,3aS,5aS,8S,10aR,10bS)-8-hydroxy-3a,5a,8-trimethyl-1-propan-2-yl-4,5,9,10,10a,10b-hexahydro-3H-cyclohepta[e]inden-3-yl] acetate.
| Compound Name | [(3S,3aS,5aS,8S,10aR,10bS)-8-hydroxy-3a,5a,8-trimethyl-1-propan-2-yl-4,5,9,10,10a,10b-hexahydro-3H-cyclohepta[e]inden-3-yl] acetate |
|---|---|
| PubChem CID | 25147132 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | [(3S,3aS,5aS,8S,10aR,10bS)-8-hydroxy-3a,5a,8-trimethyl-1-propan-2-yl-4,5,9,10,10a,10b-hexahydro-3H-cyclohepta[e]inden-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C(C(C)C)[C@@H]2[C@H]3CC[C@](C)(O)C=C[C@]3(C)CC[C@]12C |
| InChI | InChI=1S/C22H34O3/c1-14(2)16-13-18(25-15(3)23)22(6)12-10-20(4)9-11-21(5,24)8-7-17(20)19(16)22/h9,11,13-14,17-19,24H,7-8,10,12H2,1-6H3/t17-,18+,19-,20-,21+,22-/m1/s1 |
| InChIKey | NBTOPIHSUOHRCN-BGJURXJTSA-N |
| XLogP | 4.65 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|