C24H32O6 — CID 102354386
(1E,5S,10R,12Z,14R,16R,17S,20R)-16-hydroxy-2,5,13,16-tetramethyl-9-propan-2-yl-6,15,19-trioxatetracyclo[12.5.1.05,10.017,20]icosa-1,8,12-triene-7,18-dione (PubChem CID 102354386) has the molecular formula C24H32O6 and a molecular weight of 416.51 g/mol. Its IUPAC name is (1E,5S,10R,12Z,14R,16R,17S,20R)-16-hydroxy-2,5,13,16-tetramethyl-9-propan-2-yl-6,15,19-trioxatetracyclo[12.5.1.05,10.017,20]icosa-1,8,12-triene-7,18-dione.
| Compound Name | (1E,5S,10R,12Z,14R,16R,17S,20R)-16-hydroxy-2,5,13,16-tetramethyl-9-propan-2-yl-6,15,19-trioxatetracyclo[12.5.1.05,10.017,20]icosa-1,8,12-triene-7,18-dione |
|---|---|
| PubChem CID | 102354386 |
| Molecular Formula | C24H32O6 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | (1E,5S,10R,12Z,14R,16R,17S,20R)-16-hydroxy-2,5,13,16-tetramethyl-9-propan-2-yl-6,15,19-trioxatetracyclo[12.5.1.05,10.017,20]icosa-1,8,12-triene-7,18-dione |
| SMILES | C/C1=C/C[C@@H]2C(C(C)C)=CC(=O)O[C@@]2(C)CC/C(C)=C2/OC(=O)[C@H]3[C@@H]2[C@H]1O[C@@]3(C)O |
| InChI | InChI=1S/C24H32O6/c1-12(2)15-11-17(25)29-23(5)10-9-14(4)20-18-19(22(26)28-20)24(6,27)30-21(18)13(3)7-8-16(15)23/h7,11-12,16,18-19,21,27H,8-10H2,1-6H3/b13-7-,20-14+/t16-,18+,19-,21+,23+,24-/m1/s1 |
| InChIKey | YFSGXEZLCNEFQI-TUCOXLGHSA-N |
| XLogP | 3.80 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|