C24H32O6 — CID 177489233
(1Z,12E)-18-hydroxy-2,5,13,18-tetramethyl-9-propan-2-yl-6,15,19-trioxatetracyclo[12.5.1.05,10.017,20]icosa-1,8,12-triene-7,16-dione (PubChem CID 177489233) has the molecular formula C24H32O6 and a molecular weight of 416.51 g/mol. Its IUPAC name is (1Z,12E)-18-hydroxy-2,5,13,18-tetramethyl-9-propan-2-yl-6,15,19-trioxatetracyclo[12.5.1.05,10.017,20]icosa-1,8,12-triene-7,16-dione.
| Compound Name | (1Z,12E)-18-hydroxy-2,5,13,18-tetramethyl-9-propan-2-yl-6,15,19-trioxatetracyclo[12.5.1.05,10.017,20]icosa-1,8,12-triene-7,16-dione |
|---|---|
| PubChem CID | 177489233 |
| Molecular Formula | C24H32O6 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | (1Z,12E)-18-hydroxy-2,5,13,18-tetramethyl-9-propan-2-yl-6,15,19-trioxatetracyclo[12.5.1.05,10.017,20]icosa-1,8,12-triene-7,16-dione |
| SMILES | C/C1=C\CC2C(C(C)C)=CC(=O)OC2(C)CC/C(C)=C2/OC(C)(O)C3C(=O)OC1C23 |
| InChI | InChI=1S/C24H32O6/c1-12(2)15-11-17(25)29-23(5)10-9-14(4)21-18-19(24(6,27)30-21)22(26)28-20(18)13(3)7-8-16(15)23/h7,11-12,16,18-20,27H,8-10H2,1-6H3/b13-7+,21-14+ |
| InChIKey | QZJNOAIRNSKZKG-CKPCLRFGSA-N |
| XLogP | 3.80 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|