C7H10F2N2O2 — CID 156587220
2-[1-(2,2-difluoroethyl)pyrazol-4-yl]oxyethanol (PubChem CID 156587220) has the molecular formula C7H10F2N2O2 and a molecular weight of 192.16 g/mol. Its IUPAC name is 2-[1-(2,2-difluoroethyl)pyrazol-4-yl]oxyethanol.
| Compound Name | 2-[1-(2,2-difluoroethyl)pyrazol-4-yl]oxyethanol |
|---|---|
| PubChem CID | 156587220 |
| Molecular Formula | C7H10F2N2O2 |
| Molecular Weight | 192.16 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 2-[1-(2,2-difluoroethyl)pyrazol-4-yl]oxyethanol |
| SMILES | OCCOc1cnn(CC(F)F)c1 |
| InChI | InChI=1S/C7H10F2N2O2/c8-7(9)5-11-4-6(3-10-11)13-2-1-12/h3-4,7,12H,1-2,5H2 |
| InChIKey | NDOUGFALOWMKTI-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.16 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |