C5H6F2N2S2 — CID 123440795
1-(2,2-difluoroethyl)-4-(disulfanyl)pyrazole (PubChem CID 123440795) has the molecular formula C5H6F2N2S2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-4-(disulfanyl)pyrazole.
| Compound Name | 1-(2,2-difluoroethyl)-4-(disulfanyl)pyrazole |
|---|---|
| PubChem CID | 123440795 |
| Molecular Formula | C5H6F2N2S2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 195.99 |
| IUPAC Name | 1-(2,2-difluoroethyl)-4-(disulfanyl)pyrazole |
| SMILES | FC(F)Cn1cc(SS)cn1 |
| InChI | InChI=1S/C5H6F2N2S2/c6-5(7)3-9-2-4(11-10)1-8-9/h1-2,5,10H,3H2 |
| InChIKey | ZGIGSTKLDDLNMF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 17.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|