C22H23FN4O2 — CID 156589819
(1E)-1-(3-benzyl-2-oxo-4a,5,6,7,8,8a-hexahydro-1H-quinazolin-4-ylidene)-3-(4-fluorophenyl)urea (PubChem CID 156589819) has the molecular formula C22H23FN4O2 and a molecular weight of 394.45 g/mol. Its IUPAC name is (1E)-1-(3-benzyl-2-oxo-4a,5,6,7,8,8a-hexahydro-1H-quinazolin-4-ylidene)-3-(4-fluorophenyl)urea.
| Compound Name | (1E)-1-(3-benzyl-2-oxo-4a,5,6,7,8,8a-hexahydro-1H-quinazolin-4-ylidene)-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 156589819 |
| Molecular Formula | C22H23FN4O2 |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | (1E)-1-(3-benzyl-2-oxo-4a,5,6,7,8,8a-hexahydro-1H-quinazolin-4-ylidene)-3-(4-fluorophenyl)urea |
| SMILES | O=C(/N=C1\C2CCCCC2NC(=O)N1Cc1ccccc1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C22H23FN4O2/c23-16-10-12-17(13-11-16)24-21(28)26-20-18-8-4-5-9-19(18)25-22(29)27(20)14-15-6-2-1-3-7-15/h1-3,6-7,10-13,18-19H,4-5,8-9,14H2,(H,24,28)(H,25,29)/b26-20+ |
| InChIKey | QKNMODMGHJNXSN-LHLOQNFPSA-N |
| XLogP | 4.54 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|