C22H16F2N4O2 — CID 178186651
(3Z)-1-(2-fluorophenyl)-3-[3-[(4-fluorophenyl)methyl]-2-oxo-4aH-quinazolin-4-ylidene]urea (PubChem CID 178186651) has the molecular formula C22H16F2N4O2 and a molecular weight of 406.39 g/mol. Its IUPAC name is (3Z)-1-(2-fluorophenyl)-3-[3-[(4-fluorophenyl)methyl]-2-oxo-4aH-quinazolin-4-ylidene]urea.
| Compound Name | (3Z)-1-(2-fluorophenyl)-3-[3-[(4-fluorophenyl)methyl]-2-oxo-4aH-quinazolin-4-ylidene]urea |
|---|---|
| PubChem CID | 178186651 |
| Molecular Formula | C22H16F2N4O2 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | (3Z)-1-(2-fluorophenyl)-3-[3-[(4-fluorophenyl)methyl]-2-oxo-4aH-quinazolin-4-ylidene]urea |
| SMILES | O=C(/N=C1/C2C=CC=CC2=NC(=O)N1Cc1ccc(F)cc1)Nc1ccccc1F |
| InChI | InChI=1S/C22H16F2N4O2/c23-15-11-9-14(10-12-15)13-28-20(16-5-1-3-7-18(16)26-22(28)30)27-21(29)25-19-8-4-2-6-17(19)24/h1-12,16H,13H2,(H,25,29)/b27-20- |
| InChIKey | ISUWICCPDNBJDN-OOAXWGSJSA-N |
| XLogP | 4.71 |
| TPSA | 74.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|