C23H19FN4O3 — CID 178186536
(3Z)-1-(2-fluorophenyl)-3-[3-[(4-methoxyphenyl)methyl]-2-oxo-4aH-quinazolin-4-ylidene]urea (PubChem CID 178186536) has the molecular formula C23H19FN4O3 and a molecular weight of 418.43 g/mol. Its IUPAC name is (3Z)-1-(2-fluorophenyl)-3-[3-[(4-methoxyphenyl)methyl]-2-oxo-4aH-quinazolin-4-ylidene]urea.
| Compound Name | (3Z)-1-(2-fluorophenyl)-3-[3-[(4-methoxyphenyl)methyl]-2-oxo-4aH-quinazolin-4-ylidene]urea |
|---|---|
| PubChem CID | 178186536 |
| Molecular Formula | C23H19FN4O3 |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | (3Z)-1-(2-fluorophenyl)-3-[3-[(4-methoxyphenyl)methyl]-2-oxo-4aH-quinazolin-4-ylidene]urea |
| SMILES | COc1ccc(CN2C(=O)N=C3C=CC=CC3/C2=N/C(=O)Nc2ccccc2F)cc1 |
| InChI | InChI=1S/C23H19FN4O3/c1-31-16-12-10-15(11-13-16)14-28-21(17-6-2-4-8-19(17)26-23(28)30)27-22(29)25-20-9-5-3-7-18(20)24/h2-13,17H,14H2,1H3,(H,25,29)/b27-21- |
| InChIKey | HYIWXGIRRGPIGH-MEFGMAGPSA-N |
| XLogP | 4.58 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|