C20H20ClN3O5 — CID 156590505
2-[4-(3-chlorophenyl)-2,3-dioxopiperazin-1-yl]-N-(3,5-dimethoxyphenyl)acetamide (PubChem CID 156590505) has the molecular formula C20H20ClN3O5 and a molecular weight of 417.85 g/mol. Its IUPAC name is 2-[4-(3-chlorophenyl)-2,3-dioxopiperazin-1-yl]-N-(3,5-dimethoxyphenyl)acetamide.
| Compound Name | 2-[4-(3-chlorophenyl)-2,3-dioxopiperazin-1-yl]-N-(3,5-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 156590505 |
| Molecular Formula | C20H20ClN3O5 |
| Molecular Weight | 417.85 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 2-[4-(3-chlorophenyl)-2,3-dioxopiperazin-1-yl]-N-(3,5-dimethoxyphenyl)acetamide |
| SMILES | COc1cc(NC(=O)CN2CCN(c3cccc(Cl)c3)C(=O)C2=O)cc(OC)c1 |
| InChI | InChI=1S/C20H20ClN3O5/c1-28-16-9-14(10-17(11-16)29-2)22-18(25)12-23-6-7-24(20(27)19(23)26)15-5-3-4-13(21)8-15/h3-5,8-11H,6-7,12H2,1-2H3,(H,22,25) |
| InChIKey | DKNBSTWTTJJDAW-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.85 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|