C18H23N7O4 — CID 156590590
3-methyl-8-[(2E)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-7-pentyl-4,5-dihydropurine-2,6-dione (PubChem CID 156590590) has the molecular formula C18H23N7O4 and a molecular weight of 401.43 g/mol. Its IUPAC name is 3-methyl-8-[(2E)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-7-pentyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 3-methyl-8-[(2E)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-7-pentyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 156590590 |
| Molecular Formula | C18H23N7O4 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 3-methyl-8-[(2E)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-7-pentyl-4,5-dihydropurine-2,6-dione |
| SMILES | CCCCCN1C(N/N=C/c2cccc([N+](=O)[O-])c2)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C18H23N7O4/c1-3-4-5-9-24-14-15(23(2)18(27)21-16(14)26)20-17(24)22-19-11-12-7-6-8-13(10-12)25(28)29/h6-8,10-11,14-15H,3-5,9H2,1-2H3,(H,20,22)(H,21,26,27)/b19-11+ |
| InChIKey | DSDCGVISEBPENU-YBFXNURJSA-N |
| XLogP | 1.26 |
| TPSA | 132.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|