C24H26F3N5O4S — CID 156591508
2-[[7-(4-methoxyphenyl)-1,3-dimethyl-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl]sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 156591508) has the molecular formula C24H26F3N5O4S and a molecular weight of 537.56 g/mol. Its IUPAC name is 2-[[7-(4-methoxyphenyl)-1,3-dimethyl-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl]sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[[7-(4-methoxyphenyl)-1,3-dimethyl-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl]sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 156591508 |
| Molecular Formula | C24H26F3N5O4S |
| Molecular Weight | 537.56 g/mol |
| Exact Mass | 537.17 |
| IUPAC Name | 2-[[7-(4-methoxyphenyl)-1,3-dimethyl-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl]sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | COc1ccc(C2NC(SCC(=O)Nc3cccc(C(F)(F)F)c3)C3C(=O)N(C)C(=O)N(C)C3N2)cc1 |
| InChI | InChI=1S/C24H26F3N5O4S/c1-31-20-18(22(34)32(2)23(31)35)21(30-19(29-20)13-7-9-16(36-3)10-8-13)37-12-17(33)28-15-6-4-5-14(11-15)24(25,26)27/h4-11,18-21,29-30H,12H2,1-3H3,(H,28,33) |
| InChIKey | INJNRGGAYUJVMD-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.56 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |