C23H26N6O4S — CID 73450985
4-[[2-[(1,3-dimethyl-2,4-dioxo-7-phenyl-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl)sulfanyl]acetyl]amino]benzamide (PubChem CID 73450985) has the molecular formula C23H26N6O4S and a molecular weight of 482.57 g/mol. Its IUPAC name is 4-[[2-[(1,3-dimethyl-2,4-dioxo-7-phenyl-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl)sulfanyl]acetyl]amino]benzamide.
| Compound Name | 4-[[2-[(1,3-dimethyl-2,4-dioxo-7-phenyl-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl)sulfanyl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 73450985 |
| Molecular Formula | C23H26N6O4S |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 4-[[2-[(1,3-dimethyl-2,4-dioxo-7-phenyl-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl)sulfanyl]acetyl]amino]benzamide |
| SMILES | CN1C(=O)C2C(SCC(=O)Nc3ccc(C(N)=O)cc3)NC(c3ccccc3)NC2N(C)C1=O |
| InChI | InChI=1S/C23H26N6O4S/c1-28-20-17(22(32)29(2)23(28)33)21(27-19(26-20)14-6-4-3-5-7-14)34-12-16(30)25-15-10-8-13(9-11-15)18(24)31/h3-11,17,19-21,26-27H,12H2,1-2H3,(H2,24,31)(H,25,30) |
| InChIKey | VALXYGRUSBGDDW-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |