C23H26N6O6S — CID 156589831
2-[[7-(4-methoxyphenyl)-1,3-dimethyl-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl]sulfanyl]-N-(4-nitrophenyl)acetamide (PubChem CID 156589831) has the molecular formula C23H26N6O6S and a molecular weight of 514.56 g/mol. Its IUPAC name is 2-[[7-(4-methoxyphenyl)-1,3-dimethyl-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl]sulfanyl]-N-(4-nitrophenyl)acetamide.
| Compound Name | 2-[[7-(4-methoxyphenyl)-1,3-dimethyl-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl]sulfanyl]-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 156589831 |
| Molecular Formula | C23H26N6O6S |
| Molecular Weight | 514.56 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | 2-[[7-(4-methoxyphenyl)-1,3-dimethyl-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl]sulfanyl]-N-(4-nitrophenyl)acetamide |
| SMILES | COc1ccc(C2NC(SCC(=O)Nc3ccc([N+](=O)[O-])cc3)C3C(=O)N(C)C(=O)N(C)C3N2)cc1 |
| InChI | InChI=1S/C23H26N6O6S/c1-27-20-18(22(31)28(2)23(27)32)21(26-19(25-20)13-4-10-16(35-3)11-5-13)36-12-17(30)24-14-6-8-15(9-7-14)29(33)34/h4-11,18-21,25-26H,12H2,1-3H3,(H,24,30) |
| InChIKey | RTOOQRKMGDOHJW-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 146.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.56 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|