C17H21N5O5S — CID 73451069
1,3-dimethyl-7-(3-nitrophenyl)-5-(2-oxopropylsulfanyl)-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidine-2,4-dione (PubChem CID 73451069) has the molecular formula C17H21N5O5S and a molecular weight of 407.45 g/mol. Its IUPAC name is 1,3-dimethyl-7-(3-nitrophenyl)-5-(2-oxopropylsulfanyl)-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidine-2,4-dione.
| Compound Name | 1,3-dimethyl-7-(3-nitrophenyl)-5-(2-oxopropylsulfanyl)-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 73451069 |
| Molecular Formula | C17H21N5O5S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 1,3-dimethyl-7-(3-nitrophenyl)-5-(2-oxopropylsulfanyl)-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidine-2,4-dione |
| SMILES | CC(=O)CSC1NC(c2cccc([N+](=O)[O-])c2)NC2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C17H21N5O5S/c1-9(23)8-28-15-12-14(20(2)17(25)21(3)16(12)24)18-13(19-15)10-5-4-6-11(7-10)22(26)27/h4-7,12-15,18-19H,8H2,1-3H3 |
| InChIKey | ABGFPCVRSIJPBD-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 124.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|