C24H29N5O5S — CID 73329287
N-(4-methoxyphenyl)-2-[[7-(4-methoxyphenyl)-1,3-dimethyl-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl]sulfanyl]acetamide (PubChem CID 73329287) has the molecular formula C24H29N5O5S and a molecular weight of 499.59 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-[[7-(4-methoxyphenyl)-1,3-dimethyl-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl]sulfanyl]acetamide.
| Compound Name | N-(4-methoxyphenyl)-2-[[7-(4-methoxyphenyl)-1,3-dimethyl-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 73329287 |
| Molecular Formula | C24H29N5O5S |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | N-(4-methoxyphenyl)-2-[[7-(4-methoxyphenyl)-1,3-dimethyl-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl]sulfanyl]acetamide |
| SMILES | COc1ccc(NC(=O)CSC2NC(c3ccc(OC)cc3)NC3C2C(=O)N(C)C(=O)N3C)cc1 |
| InChI | InChI=1S/C24H29N5O5S/c1-28-21-19(23(31)29(2)24(28)32)22(27-20(26-21)14-5-9-16(33-3)10-6-14)35-13-18(30)25-15-7-11-17(34-4)12-8-15/h5-12,19-22,26-27H,13H2,1-4H3,(H,25,30) |
| InChIKey | MYIXNORKTUCHPS-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |