C19H26FN5O3S — CID 167998773
2-[(1,3-dimethyl-2,4-dioxo-7-propyl-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl)sulfanyl]-N-(4-fluorophenyl)acetamide (PubChem CID 167998773) has the molecular formula C19H26FN5O3S and a molecular weight of 423.51 g/mol. Its IUPAC name is 2-[(1,3-dimethyl-2,4-dioxo-7-propyl-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl)sulfanyl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[(1,3-dimethyl-2,4-dioxo-7-propyl-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl)sulfanyl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 167998773 |
| Molecular Formula | C19H26FN5O3S |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 2-[(1,3-dimethyl-2,4-dioxo-7-propyl-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl)sulfanyl]-N-(4-fluorophenyl)acetamide |
| SMILES | CCCC1NC(SCC(=O)Nc2ccc(F)cc2)C2C(=O)N(C)C(=O)N(C)C2N1 |
| InChI | InChI=1S/C19H26FN5O3S/c1-4-5-13-22-16-15(18(27)25(3)19(28)24(16)2)17(23-13)29-10-14(26)21-12-8-6-11(20)7-9-12/h6-9,13,15-17,22-23H,4-5,10H2,1-3H3,(H,21,26) |
| InChIKey | SMCGJDUYTSQXGQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |