C25H31N5O3S — CID 73450994
2-[[1,3-dimethyl-7-(3-methylphenyl)-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl]sulfanyl]-N-(2-phenylethyl)acetamide (PubChem CID 73450994) has the molecular formula C25H31N5O3S and a molecular weight of 481.62 g/mol. Its IUPAC name is 2-[[1,3-dimethyl-7-(3-methylphenyl)-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl]sulfanyl]-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[[1,3-dimethyl-7-(3-methylphenyl)-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl]sulfanyl]-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 73450994 |
| Molecular Formula | C25H31N5O3S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | 2-[[1,3-dimethyl-7-(3-methylphenyl)-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl]sulfanyl]-N-(2-phenylethyl)acetamide |
| SMILES | Cc1cccc(C2NC(SCC(=O)NCCc3ccccc3)C3C(=O)N(C)C(=O)N(C)C3N2)c1 |
| InChI | InChI=1S/C25H31N5O3S/c1-16-8-7-11-18(14-16)21-27-22-20(24(32)30(3)25(33)29(22)2)23(28-21)34-15-19(31)26-13-12-17-9-5-4-6-10-17/h4-11,14,20-23,27-28H,12-13,15H2,1-3H3,(H,26,31) |
| InChIKey | OBRJZIDGGYXSKH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |