C8H9N5O — CID 156595026
7-ethyl-2-imino-4aH-pteridin-4-one (PubChem CID 156595026) has the molecular formula C8H9N5O and a molecular weight of 191.19 g/mol. Its IUPAC name is 7-ethyl-2-imino-4aH-pteridin-4-one.
| Compound Name | 7-ethyl-2-imino-4aH-pteridin-4-one |
|---|---|
| PubChem CID | 156595026 |
| Molecular Formula | C8H9N5O |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 7-ethyl-2-imino-4aH-pteridin-4-one |
| SMILES | [H]/N=C1\N=C2N=C(CC)C=NC2C(=O)N1 |
| InChI | InChI=1S/C8H9N5O/c1-2-4-3-10-5-6(11-4)12-8(9)13-7(5)14/h3,5H,2H2,1H3,(H2,9,13,14) |
| InChIKey | WKTQHYURXZUWEF-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|