C40H52O18 — CID 156595894
Phyllanthostatin 2-Phyllanthus acuminatus (PubChem CID 156595894) has the molecular formula C40H52O18 and a molecular weight of 820.84 g/mol.
| Compound Name | Phyllanthostatin 2-Phyllanthus acuminatus |
|---|---|
| PubChem CID | 156595894 |
| Molecular Formula | C40H52O18 |
| Molecular Weight | 820.84 g/mol |
| Exact Mass | 820.32 |
| IUPAC Name | — |
| SMILES | CC(=O)O[C@@H]1[C@@H](O)[C@H](O[C@H]2[C@H](OC(=O)[C@H]3CC[C@H]4[C@@H](C3)O[C@@]3(C[C@H](OC(=O)/C=C/c5ccccc5)[C@H](C)CO3)[C@]43CO3)O[C@H](CO)[C@@H](O)[C@@H]2OC(C)=O)O[C@H](C)[C@H]1O |
| InChI | InChI=1S/C40H52O18/c1-19-17-49-40(15-27(19)54-29(44)13-10-23-8-6-5-7-9-23)39(18-50-39)25-12-11-24(14-26(25)58-40)36(48)57-38-35(34(53-22(4)43)31(46)28(16-41)55-38)56-37-32(47)33(52-21(3)42)30(45)20(2)51-37/h5-10,13,19-20,24-28,30-35,37-38,41,45-47H,11-12,14-18H2,1-4H3/b13-10+/t19-,20-,24+,25+,26-,27+,28-,30-,31-,32-,33+,34+,35-,37+,38+,39+,40+/m1/s1 |
| InChIKey | JPSGWRGLQYPUMR-FCZSQQPFSA-N |
| XLogP | 0.28 |
| TPSA | 244.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.84 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|