C40H52O17 — CID 154497210
CID 154497210 (PubChem CID 154497210) has the molecular formula C40H52O17 and a molecular weight of 804.84 g/mol.
| Compound Name | CID 154497210 |
|---|---|
| PubChem CID | 154497210 |
| Molecular Formula | C40H52O17 |
| Molecular Weight | 804.84 g/mol |
| Exact Mass | 804.32 |
| IUPAC Name | — |
| SMILES | CC(=O)O[C@@H]1[C@H](O)[C@H](O[C@@H]2[C@@H](OC(=O)[C@@H]3CC[C@@H]4[C@H](C3)O[C@]3(C[C@@H](OC(=O)/C=C/c5ccccc5)[C@@H](C)CO3)[C@@]43CO3)O[C@@H](C)[C@@H](OC(C)=O)[C@H]2O)O[C@@H](C)[C@H]1O |
| InChI | InChI=1S/C40H52O17/c1-19-17-48-40(16-28(19)54-29(43)14-11-24-9-7-6-8-10-24)39(18-49-39)26-13-12-25(15-27(26)57-40)36(47)56-38-35(31(45)33(21(3)51-38)52-22(4)41)55-37-32(46)34(53-23(5)42)30(44)20(2)50-37/h6-11,14,19-21,25-28,30-35,37-38,44-46H,12-13,15-18H2,1-5H3/b14-11+/t19-,20-,21-,25+,26+,27-,28+,30+,31+,32-,33+,34-,35-,37-,38+,39+,40+/m0/s1 |
| InChIKey | QJTFVHQEZWKQOM-UIZGOMJYSA-N |
| XLogP | 1.31 |
| TPSA | 224.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.84 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|