C21H27NO — CID 156599683
5-(3,6-dimethyl-1-phenylhept-5-en-3-yl)-2-methoxypyridine (PubChem CID 156599683) has the molecular formula C21H27NO and a molecular weight of 309.45 g/mol. Its IUPAC name is 5-(3,6-dimethyl-1-phenylhept-5-en-3-yl)-2-methoxypyridine.
| Compound Name | 5-(3,6-dimethyl-1-phenylhept-5-en-3-yl)-2-methoxypyridine |
|---|---|
| PubChem CID | 156599683 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 5-(3,6-dimethyl-1-phenylhept-5-en-3-yl)-2-methoxypyridine |
| SMILES | COc1ccc(C(C)(CC=C(C)C)CCc2ccccc2)cn1 |
| InChI | InChI=1S/C21H27NO/c1-17(2)12-14-21(3,15-13-18-8-6-5-7-9-18)19-10-11-20(23-4)22-16-19/h5-12,16H,13-15H2,1-4H3 |
| InChIKey | WBCQUHHAIPDFLN-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|