C10H6BrClN2O2S — CID 156601185
(5Z)-5-[(5-bromo-3-chloro-2-hydroxyphenyl)methylidene]-2-imino-1,3-thiazolidin-4-one (PubChem CID 156601185) has the molecular formula C10H6BrClN2O2S and a molecular weight of 333.59 g/mol. Its IUPAC name is (5Z)-5-[(5-bromo-3-chloro-2-hydroxyphenyl)methylidene]-2-imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(5-bromo-3-chloro-2-hydroxyphenyl)methylidene]-2-imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 156601185 |
| Molecular Formula | C10H6BrClN2O2S |
| Molecular Weight | 333.59 g/mol |
| Exact Mass | 331.90 |
| IUPAC Name | (5Z)-5-[(5-bromo-3-chloro-2-hydroxyphenyl)methylidene]-2-imino-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\NC(=O)/C(=C/c2cc(Br)cc(Cl)c2O)S1 |
| InChI | InChI=1S/C10H6BrClN2O2S/c11-5-1-4(8(15)6(12)3-5)2-7-9(16)14-10(13)17-7/h1-3,15H,(H2,13,14,16)/b7-2- |
| InChIKey | YFIFRZLOKVWADU-UQCOIBPSSA-N |
| XLogP | 2.95 |
| TPSA | 73.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.59 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|