C22H24FNO2 — CID 156602485
[(3S)-7-phenylspiro[3.5]nonan-3-yl] N-(3-fluorophenyl)carbamate (PubChem CID 156602485) has the molecular formula C22H24FNO2 and a molecular weight of 353.44 g/mol. Its IUPAC name is [(3S)-7-phenylspiro[3.5]nonan-3-yl] N-(3-fluorophenyl)carbamate.
| Compound Name | [(3S)-7-phenylspiro[3.5]nonan-3-yl] N-(3-fluorophenyl)carbamate |
|---|---|
| PubChem CID | 156602485 |
| Molecular Formula | C22H24FNO2 |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | [(3S)-7-phenylspiro[3.5]nonan-3-yl] N-(3-fluorophenyl)carbamate |
| SMILES | O=C(Nc1cccc(F)c1)O[C@H]1CCC12CCC(c1ccccc1)CC2 |
| InChI | InChI=1S/C22H24FNO2/c23-18-7-4-8-19(15-18)24-21(25)26-20-11-14-22(20)12-9-17(10-13-22)16-5-2-1-3-6-16/h1-8,15,17,20H,9-14H2,(H,24,25)/t17?,20-,22?/m0/s1 |
| InChIKey | PMLFLOWRPDPWQV-DHHCDUQHSA-N |
| XLogP | 5.88 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |