About (5-oxopyrrolidin-3-yl) N-(3-fluorophenyl)carbamate
(5-oxopyrrolidin-3-yl) N-(3-fluorophenyl)carbamate (PubChem CID 13195030) has the molecular formula C11H11FN2O3
and a molecular weight of 238.22 g/mol. Its IUPAC name is (5-oxopyrrolidin-3-yl) N-(3-fluorophenyl)carbamate.
Molecular Properties
| Compound Name | (5-oxopyrrolidin-3-yl) N-(3-fluorophenyl)carbamate |
| PubChem CID | 13195030 |
| Molecular Formula | C11H11FN2O3 |
| Molecular Weight | 238.22 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | (5-oxopyrrolidin-3-yl) N-(3-fluorophenyl)carbamate |
| SMILES | O=C1CC(OC(=O)Nc2cccc(F)c2)CN1 |
| InChI | InChI=1S/C11H11FN2O3/c12-7-2-1-3-8(4-7)14-11(16)17-9-5-10(15)13-6-9/h1-4,9H,5-6H2,(H,13,15)(H,14,16) |
| InChIKey | OXDXMEOFAPTHKS-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.22 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-oxopyrrolidin-3-yl) N-(3-fluorophenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-oxopyrrolidin-3-yl) N-(3-fluorophenyl)carbamate?
The IUPAC name of (5-oxopyrrolidin-3-yl) N-(3-fluorophenyl)carbamate (CID 13195030) is (5-oxopyrrolidin-3-yl) N-(3-fluorophenyl)carbamate.
What is the SMILES notation for (5-oxopyrrolidin-3-yl) N-(3-fluorophenyl)carbamate?
The canonical SMILES for (5-oxopyrrolidin-3-yl) N-(3-fluorophenyl)carbamate is O=C1CC(OC(=O)Nc2cccc(F)c2)CN1.
What is the InChIKey of (5-oxopyrrolidin-3-yl) N-(3-fluorophenyl)carbamate?
The InChIKey is OXDXMEOFAPTHKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11FN2O3/c12-7-2-1-3-8(4-7)14-11(16)17-9-5-10(15)13-6-9/h1-4,9H,5-6H2,(H,13,15)(H,14,16).
What are the key properties of (5-oxopyrrolidin-3-yl) N-(3-fluorophenyl)carbamate?
(5-oxopyrrolidin-3-yl) N-(3-fluorophenyl)carbamate has a molecular weight of 238.22 g/mol, XLogP of 1.26, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-oxopyrrolidin-3-yl) N-(3-fluorophenyl)carbamate is sourced from PubChem (CID 13195030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).