C11H11FN2O3 — CID 13195030
(5-oxopyrrolidin-3-yl) N-(3-fluorophenyl)carbamate (PubChem CID 13195030) has the molecular formula C11H11FN2O3 and a molecular weight of 238.22 g/mol. Its IUPAC name is (5-oxopyrrolidin-3-yl) N-(3-fluorophenyl)carbamate.
| Compound Name | (5-oxopyrrolidin-3-yl) N-(3-fluorophenyl)carbamate |
|---|---|
| PubChem CID | 13195030 |
| Molecular Formula | C11H11FN2O3 |
| Molecular Weight | 238.22 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | (5-oxopyrrolidin-3-yl) N-(3-fluorophenyl)carbamate |
| SMILES | O=C1CC(OC(=O)Nc2cccc(F)c2)CN1 |
| InChI | InChI=1S/C11H11FN2O3/c12-7-2-1-3-8(4-7)14-11(16)17-9-5-10(15)13-6-9/h1-4,9H,5-6H2,(H,13,15)(H,14,16) |
| InChIKey | OXDXMEOFAPTHKS-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.22 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |