C15H15Cl2FN2O3 — CID 99788681
[1-[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]azetidin-3-yl] N-(3-fluorophenyl)carbamate (PubChem CID 99788681) has the molecular formula C15H15Cl2FN2O3 and a molecular weight of 361.20 g/mol. Its IUPAC name is [1-[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]azetidin-3-yl] N-(3-fluorophenyl)carbamate.
| Compound Name | [1-[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]azetidin-3-yl] N-(3-fluorophenyl)carbamate |
|---|---|
| PubChem CID | 99788681 |
| Molecular Formula | C15H15Cl2FN2O3 |
| Molecular Weight | 361.20 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | [1-[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]azetidin-3-yl] N-(3-fluorophenyl)carbamate |
| SMILES | C[C@]1(C(=O)N2CC(OC(=O)Nc3cccc(F)c3)C2)CC1(Cl)Cl |
| InChI | InChI=1S/C15H15Cl2FN2O3/c1-14(8-15(14,16)17)12(21)20-6-11(7-20)23-13(22)19-10-4-2-3-9(18)5-10/h2-5,11H,6-8H2,1H3,(H,19,22)/t14-/m1/s1 |
| InChIKey | QHLDAGFKTYCYEM-CQSZACIVSA-N |
| XLogP | 3.17 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.20 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|