C12H20N4O4S — CID 156608033
1-methyl-N-(4-morpholin-4-yloxolan-3-yl)pyrazole-4-sulfonamide (PubChem CID 156608033) has the molecular formula C12H20N4O4S and a molecular weight of 316.38 g/mol. Its IUPAC name is 1-methyl-N-(4-morpholin-4-yloxolan-3-yl)pyrazole-4-sulfonamide.
| Compound Name | 1-methyl-N-(4-morpholin-4-yloxolan-3-yl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 156608033 |
| Molecular Formula | C12H20N4O4S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 1-methyl-N-(4-morpholin-4-yloxolan-3-yl)pyrazole-4-sulfonamide |
| SMILES | Cn1cc(S(=O)(=O)NC2COCC2N2CCOCC2)cn1 |
| InChI | InChI=1S/C12H20N4O4S/c1-15-7-10(6-13-15)21(17,18)14-11-8-20-9-12(11)16-2-4-19-5-3-16/h6-7,11-12,14H,2-5,8-9H2,1H3 |
| InChIKey | JZXPUXXJOALLPA-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |