C23H29N3O3 — CID 156611146
N-[1-[4-(2,5-dimethylpyrrol-1-yl)benzoyl]-4-(hydroxymethyl)piperidin-3-yl]cyclopropanecarboxamide (PubChem CID 156611146) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is N-[1-[4-(2,5-dimethylpyrrol-1-yl)benzoyl]-4-(hydroxymethyl)piperidin-3-yl]cyclopropanecarboxamide.
| Compound Name | N-[1-[4-(2,5-dimethylpyrrol-1-yl)benzoyl]-4-(hydroxymethyl)piperidin-3-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 156611146 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | N-[1-[4-(2,5-dimethylpyrrol-1-yl)benzoyl]-4-(hydroxymethyl)piperidin-3-yl]cyclopropanecarboxamide |
| SMILES | Cc1ccc(C)n1-c1ccc(C(=O)N2CCC(CO)C(NC(=O)C3CC3)C2)cc1 |
| InChI | InChI=1S/C23H29N3O3/c1-15-3-4-16(2)26(15)20-9-7-18(8-10-20)23(29)25-12-11-19(14-27)21(13-25)24-22(28)17-5-6-17/h3-4,7-10,17,19,21,27H,5-6,11-14H2,1-2H3,(H,24,28) |
| InChIKey | RIKLFWLWYANKOV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|