C27H32N2O4 — CID 156612744
(2S,3R)-6,6-dimethyl-3-[4-(2-methylprop-2-enoyl)piperazine-1-carbonyl]-2-(2-phenylethenyl)-2,3,5,7-tetrahydro-1-benzofuran-4-one (PubChem CID 156612744) has the molecular formula C27H32N2O4 and a molecular weight of 448.56 g/mol. Its IUPAC name is (2S,3R)-6,6-dimethyl-3-[4-(2-methylprop-2-enoyl)piperazine-1-carbonyl]-2-(2-phenylethenyl)-2,3,5,7-tetrahydro-1-benzofuran-4-one.
| Compound Name | (2S,3R)-6,6-dimethyl-3-[4-(2-methylprop-2-enoyl)piperazine-1-carbonyl]-2-(2-phenylethenyl)-2,3,5,7-tetrahydro-1-benzofuran-4-one |
|---|---|
| PubChem CID | 156612744 |
| Molecular Formula | C27H32N2O4 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | (2S,3R)-6,6-dimethyl-3-[4-(2-methylprop-2-enoyl)piperazine-1-carbonyl]-2-(2-phenylethenyl)-2,3,5,7-tetrahydro-1-benzofuran-4-one |
| SMILES | C=C(C)C(=O)N1CCN(C(=O)[C@@H]2C3=C(CC(C)(C)CC3=O)O[C@H]2C=Cc2ccccc2)CC1 |
| InChI | InChI=1S/C27H32N2O4/c1-18(2)25(31)28-12-14-29(15-13-28)26(32)24-21(11-10-19-8-6-5-7-9-19)33-22-17-27(3,4)16-20(30)23(22)24/h5-11,21,24H,1,12-17H2,2-4H3/t21-,24-/m0/s1 |
| InChIKey | JEZBIGOSQJDNNR-URXFXBBRSA-N |
| XLogP | 3.60 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|