C14H23F3O2 — CID 156621974
3,7-diethyl-6-hydroxy-7-(trifluoromethyl)non-5-en-4-one (PubChem CID 156621974) has the molecular formula C14H23F3O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 3,7-diethyl-6-hydroxy-7-(trifluoromethyl)non-5-en-4-one.
| Compound Name | 3,7-diethyl-6-hydroxy-7-(trifluoromethyl)non-5-en-4-one |
|---|---|
| PubChem CID | 156621974 |
| Molecular Formula | C14H23F3O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 3,7-diethyl-6-hydroxy-7-(trifluoromethyl)non-5-en-4-one |
| SMILES | CCC(CC)C(=O)C=C(O)C(CC)(CC)C(F)(F)F |
| InChI | InChI=1S/C14H23F3O2/c1-5-10(6-2)11(18)9-12(19)13(7-3,8-4)14(15,16)17/h9-10,19H,5-8H2,1-4H3 |
| InChIKey | LGUYKKIIHDWDSH-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|