About copper;(Z)-6-ethyl-3-hydroxy-2,2-dimethyldec-3-en-5-one
copper;(Z)-6-ethyl-3-hydroxy-2,2-dimethyldec-3-en-5-one (PubChem CID 23594319) has the molecular formula C14H26CuO2
and a molecular weight of 289.91 g/mol. Its IUPAC name is copper;(Z)-6-ethyl-3-hydroxy-2,2-dimethyldec-3-en-5-one.
Molecular Properties
| Compound Name | copper;(Z)-6-ethyl-3-hydroxy-2,2-dimethyldec-3-en-5-one |
| PubChem CID | 23594319 |
| Molecular Formula | C14H26CuO2 |
| Molecular Weight | 289.91 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | copper;(Z)-6-ethyl-3-hydroxy-2,2-dimethyldec-3-en-5-one |
| SMILES | CCCCC(CC)C(=O)/C=C(\O)C(C)(C)C.[Cu] |
| InChI | InChI=1S/C14H26O2.Cu/c1-6-8-9-11(7-2)12(15)10-13(16)14(3,4)5;/h10-11,16H,6-9H2,1-5H3;/b13-10-; |
| InChIKey | JGTLVQIRDFBHHX-ALUHPYBCSA-N |
| XLogP | 4.26 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.91 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze copper;(Z)-6-ethyl-3-hydroxy-2,2-dimethyldec-3-en-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;(Z)-6-ethyl-3-hydroxy-2,2-dimethyldec-3-en-5-one?
The IUPAC name of copper;(Z)-6-ethyl-3-hydroxy-2,2-dimethyldec-3-en-5-one (CID 23594319) is copper;(Z)-6-ethyl-3-hydroxy-2,2-dimethyldec-3-en-5-one.
What is the SMILES notation for copper;(Z)-6-ethyl-3-hydroxy-2,2-dimethyldec-3-en-5-one?
The canonical SMILES for copper;(Z)-6-ethyl-3-hydroxy-2,2-dimethyldec-3-en-5-one is CCCCC(CC)C(=O)/C=C(\O)C(C)(C)C.[Cu].
What is the InChIKey of copper;(Z)-6-ethyl-3-hydroxy-2,2-dimethyldec-3-en-5-one?
The InChIKey is JGTLVQIRDFBHHX-ALUHPYBCSA-N. The full InChI is InChI=1S/C14H26O2.Cu/c1-6-8-9-11(7-2)12(15)10-13(16)14(3,4)5;/h10-11,16H,6-9H2,1-5H3;/b13-10-;.
What are the key properties of copper;(Z)-6-ethyl-3-hydroxy-2,2-dimethyldec-3-en-5-one?
copper;(Z)-6-ethyl-3-hydroxy-2,2-dimethyldec-3-en-5-one has a molecular weight of 289.91 g/mol, XLogP of 4.26, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for copper;(Z)-6-ethyl-3-hydroxy-2,2-dimethyldec-3-en-5-one is sourced from PubChem (CID 23594319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).