C14H26CuO2 — CID 23594319
copper;(Z)-6-ethyl-3-hydroxy-2,2-dimethyldec-3-en-5-one (PubChem CID 23594319) has the molecular formula C14H26CuO2 and a molecular weight of 289.91 g/mol. Its IUPAC name is copper;(Z)-6-ethyl-3-hydroxy-2,2-dimethyldec-3-en-5-one.
| Compound Name | copper;(Z)-6-ethyl-3-hydroxy-2,2-dimethyldec-3-en-5-one |
|---|---|
| PubChem CID | 23594319 |
| Molecular Formula | C14H26CuO2 |
| Molecular Weight | 289.91 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | copper;(Z)-6-ethyl-3-hydroxy-2,2-dimethyldec-3-en-5-one |
| SMILES | CCCCC(CC)C(=O)/C=C(\O)C(C)(C)C.[Cu] |
| InChI | InChI=1S/C14H26O2.Cu/c1-6-8-9-11(7-2)12(15)10-13(16)14(3,4)5;/h10-11,16H,6-9H2,1-5H3;/b13-10-; |
| InChIKey | JGTLVQIRDFBHHX-ALUHPYBCSA-N |
| XLogP | 4.26 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.91 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|