C8H11F3O2 — CID 153484564
1,1,1-trifluoro-2-hydroxy-5-methylhept-2-en-4-one (PubChem CID 153484564) has the molecular formula C8H11F3O2 and a molecular weight of 196.17 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-hydroxy-5-methylhept-2-en-4-one.
| Compound Name | 1,1,1-trifluoro-2-hydroxy-5-methylhept-2-en-4-one |
|---|---|
| PubChem CID | 153484564 |
| Molecular Formula | C8H11F3O2 |
| Molecular Weight | 196.17 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 1,1,1-trifluoro-2-hydroxy-5-methylhept-2-en-4-one |
| SMILES | CCC(C)C(=O)C=C(O)C(F)(F)F |
| InChI | InChI=1S/C8H11F3O2/c1-3-5(2)6(12)4-7(13)8(9,10)11/h4-5,13H,3H2,1-2H3 |
| InChIKey | DJBJRXLSCICOMQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.17 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|