About CID 156622945
CID 156622945 (PubChem CID 156622945) has the molecular formula C46H36BN5OSi
and a molecular weight of 713.73 g/mol.
Molecular Properties
| Compound Name | CID 156622945 |
| PubChem CID | 156622945 |
| Molecular Formula | C46H36BN5OSi |
| Molecular Weight | 713.73 g/mol |
| Exact Mass | 713.28 |
| IUPAC Name | — |
| SMILES | Cc1cccc(C)c1N1B2c3ccccc3-c3cccnc3N2c2cc(Oc3ccc4c(c3)-n3[c-][n+](-c5ccccc5)c5cccc(c53)[Si]4(C)C)ccc21 |
| InChI | InChI=1S/C46H36BN5OSi/c1-30-13-10-14-31(2)44(30)51-38-24-22-33(27-40(38)52-46-36(18-12-26-48-46)35-17-8-9-19-37(35)47(51)52)53-34-23-25-42-41(28-34)50-29-49(32-15-6-5-7-16-32)39-20-11-21-43(45(39)50)54(42,3)4/h5-28H,1-4H3 |
| InChIKey | UPMRYLJYWVRICB-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 37.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 713.73 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 156622945 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 156622945?
The IUPAC name of CID 156622945 (CID 156622945) is not available.
What is the SMILES notation for CID 156622945?
The canonical SMILES for CID 156622945 is Cc1cccc(C)c1N1B2c3ccccc3-c3cccnc3N2c2cc(Oc3ccc4c(c3)-n3[c-][n+](-c5ccccc5)c5cccc(c53)[Si]4(C)C)ccc21.
What is the InChIKey of CID 156622945?
The InChIKey is UPMRYLJYWVRICB-UHFFFAOYSA-N. The full InChI is InChI=1S/C46H36BN5OSi/c1-30-13-10-14-31(2)44(30)51-38-24-22-33(27-40(38)52-46-36(18-12-26-48-46)35-17-8-9-19-37(35)47(51)52)53-34-23-25-42-41(28-34)50-29-49(32-15-6-5-7-16-32)39-20-11-21-43(45(39)50)54(42,3)4/h5-28H,1-4H3.
What are the key properties of CID 156622945?
CID 156622945 has a molecular weight of 713.73 g/mol, XLogP of 8.31, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 156622945 is sourced from PubChem (CID 156622945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).