C66H49BN4O3Si — CID 164729023
CID 164729023 (PubChem CID 164729023) has the molecular formula C66H49BN4O3Si and a molecular weight of 985.04 g/mol.
| Compound Name | CID 164729023 |
|---|---|
| PubChem CID | 164729023 |
| Molecular Formula | C66H49BN4O3Si |
| Molecular Weight | 985.04 g/mol |
| Exact Mass | 984.37 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-n2c3cc(Oc4ccc5c(c4)-n4[c-][n+](-c6c(-c7ccccc7)cccc6-c6ccccc6)c6cccc(c64)[Si]5(C)C)ccc3c3c4c5c(cc32)Oc2ccccc2B5c2ccccc2O4)c1 |
| InChI | InChI=1S/C66H49BN4O3Si/c1-66(2,3)43-34-35-68-60(36-43)71-52-37-44(30-32-48(52)61-54(71)39-57-62-65(61)74-56-28-15-13-25-50(56)67(62)49-24-12-14-27-55(49)73-57)72-45-31-33-58-53(38-45)70-40-69(51-26-17-29-59(64(51)70)75(58,4)5)63-46(41-18-8-6-9-19-41)22-16-23-47(63)42-20-10-7-11-21-42/h6-39H,1-5H3 |
| InChIKey | GSEAEEISPDDFPE-UHFFFAOYSA-N |
| XLogP | 12.49 |
| TPSA | 54.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 985.04 |
| LogP ≤ 5 | 12.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|