C54H48BN5OSi — CID 166043759
CID 166043759 (PubChem CID 166043759) has the molecular formula C54H48BN5OSi and a molecular weight of 824.93 g/mol.
| Compound Name | CID 166043759 |
|---|---|
| PubChem CID | 166043759 |
| Molecular Formula | C54H48BN5OSi |
| Molecular Weight | 824.93 g/mol |
| Exact Mass | 824.39 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])[n+]1[c-]n2c3c1B(c1c(-c4ccccc4)cccc1-c1ccccc1)N(C)C=C3[Si](C)(C)c1ccc(Oc3ccc4c5ccccc5n(-c5cc(C(C)(C)C)ccn5)c4c3)cc1-2 |
| InChI | InChI=1S/C54H48BN5OSi/c1-54(2,3)38-29-30-56-50(31-38)60-45-24-15-14-21-43(45)44-27-25-39(32-46(44)60)61-40-26-28-48-47(33-40)59-35-57(4)53-52(59)49(62(48,6)7)34-58(5)55(53)51-41(36-17-10-8-11-18-36)22-16-23-42(51)37-19-12-9-13-20-37/h8-34H,1-7H3/i4D3 |
| InChIKey | SPYRIIHMQSFWAO-GKOSEXJESA-N |
| XLogP | 9.88 |
| TPSA | 39.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.93 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|