C54H46BN5OPtSi-2 — CID 166043758
CID 166043758 (PubChem CID 166043758) has the molecular formula C54H46BN5OPtSi-2 and a molecular weight of 1017.99 g/mol.
| Compound Name | CID 166043758 |
|---|---|
| PubChem CID | 166043758 |
| Molecular Formula | C54H46BN5OPtSi-2 |
| Molecular Weight | 1017.99 g/mol |
| Exact Mass | 1017.34 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])[n+]1[c-]n2c3c1B(c1c(-c4ccccc4)cccc1-c1ccccc1)N(C)C=C3[Si](C)(C)c1ccc(Oc3[c-]c4c(cc3)c3ccccc3n4-c3cc(C(C)(C)C)ccn3)[c-]c1-2.[Pt] |
| InChI | InChI=1S/C54H46BN5OSi.Pt/c1-54(2,3)38-29-30-56-50(31-38)60-45-24-15-14-21-43(45)44-27-25-39(32-46(44)60)61-40-26-28-48-47(33-40)59-35-57(4)53-52(59)49(62(48,6)7)34-58(5)55(53)51-41(36-17-10-8-11-18-36)22-16-23-42(51)37-19-12-9-13-20-37;/h8-31,34H,1-7H3;/q-2;/i4D3; |
| InChIKey | KYNPAXFMXKMTSQ-NXIGQQGZSA-N |
| XLogP | 9.48 |
| TPSA | 39.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1017.99 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|