About CID 156623287
CID 156623287 (PubChem CID 156623287) has the molecular formula C47H34BN5OPt-2
and a molecular weight of 890.71 g/mol.
Molecular Properties
| Compound Name | CID 156623287 |
| PubChem CID | 156623287 |
| Molecular Formula | C47H34BN5OPt-2 |
| Molecular Weight | 890.71 g/mol |
| Exact Mass | 890.25 |
| IUPAC Name | — |
| SMILES | Cc1cccc(C)c1N1B2c3ccccc3-c3cccnc3N2c2[c-]c(Oc3[c-]c4c(cc3)C(C)(C)c3cccc5c3n-4[c-][n+]5-c3ccccc3)ccc21.[Pt] |
| InChI | InChI=1S/C47H34BN5O.Pt/c1-30-13-10-14-31(2)44(30)52-40-25-23-34(28-43(40)53-46-36(18-12-26-49-46)35-17-8-9-20-39(35)48(52)53)54-33-22-24-37-42(27-33)51-29-50(32-15-6-5-7-16-32)41-21-11-19-38(45(41)51)47(37,3)4;/h5-26H,1-4H3;/q-2; |
| InChIKey | SCPALQMLXPKTQR-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 37.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 55 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 890.71 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 156623287 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 156623287?
The IUPAC name of CID 156623287 (CID 156623287) is not available.
What is the SMILES notation for CID 156623287?
The canonical SMILES for CID 156623287 is Cc1cccc(C)c1N1B2c3ccccc3-c3cccnc3N2c2[c-]c(Oc3[c-]c4c(cc3)C(C)(C)c3cccc5c3n-4[c-][n+]5-c3ccccc3)ccc21.[Pt].
What is the InChIKey of CID 156623287?
The InChIKey is SCPALQMLXPKTQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C47H34BN5O.Pt/c1-30-13-10-14-31(2)44(30)52-40-25-23-34(28-43(40)53-46-36(18-12-26-49-46)35-17-8-9-20-39(35)48(52)53)54-33-22-24-37-42(27-33)51-29-50(32-15-6-5-7-16-32)41-21-11-19-38(45(41)51)47(37,3)4;/h5-26H,1-4H3;/q-2;.
What are the key properties of CID 156623287?
CID 156623287 has a molecular weight of 890.71 g/mol, XLogP of 9.41, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 156623287 is sourced from PubChem (CID 156623287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).