C54H45BN4O2 — CID 156623054
3-[3-tert-butyl-5-[3-[3-(2,6-diphenylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]phenyl]-2-(2,6-dimethylphenyl)-[1,3,2]oxazaborolo[4,5-b]pyridine (PubChem CID 156623054) has the molecular formula C54H45BN4O2 and a molecular weight of 792.79 g/mol. Its IUPAC name is 3-[3-tert-butyl-5-[3-[3-(2,6-diphenylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]phenyl]-2-(2,6-dimethylphenyl)-[1,3,2]oxazaborolo[4,5-b]pyridine.
| Compound Name | 3-[3-tert-butyl-5-[3-[3-(2,6-diphenylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]phenyl]-2-(2,6-dimethylphenyl)-[1,3,2]oxazaborolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 156623054 |
| Molecular Formula | C54H45BN4O2 |
| Molecular Weight | 792.79 g/mol |
| Exact Mass | 792.36 |
| IUPAC Name | 3-[3-tert-butyl-5-[3-[3-(2,6-diphenylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]phenyl]-2-(2,6-dimethylphenyl)-[1,3,2]oxazaborolo[4,5-b]pyridine |
| SMILES | Cc1cccc(C)c1B1Oc2cccnc2N1c1cc(Oc2cccc(-n3[c-][n+](-c4c(-c5ccccc5)cccc4-c4ccccc4)c4ccccc43)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C54H45BN4O2/c1-37-18-14-19-38(2)51(37)55-59(53-50(61-55)30-17-31-56-53)43-32-41(54(3,4)5)33-45(35-43)60-44-25-15-24-42(34-44)57-36-58(49-29-13-12-28-48(49)57)52-46(39-20-8-6-9-21-39)26-16-27-47(52)40-22-10-7-11-23-40/h6-35H,1-5H3 |
| InChIKey | AIHCNJPACNAHLN-UHFFFAOYSA-N |
| XLogP | 12.07 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.79 |
| LogP ≤ 5 | 12.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|