C37H28BN5O — CID 156623276
3-[3-[3-(3-methyl-2H-benzimidazol-3-ium-2-id-1-yl)phenoxy]phenyl]-1,2-diphenyl-[1,3,2]diazaborolo[4,5-b]pyridine (PubChem CID 156623276) has the molecular formula C37H28BN5O and a molecular weight of 569.48 g/mol. Its IUPAC name is 3-[3-[3-(3-methyl-2H-benzimidazol-3-ium-2-id-1-yl)phenoxy]phenyl]-1,2-diphenyl-[1,3,2]diazaborolo[4,5-b]pyridine.
| Compound Name | 3-[3-[3-(3-methyl-2H-benzimidazol-3-ium-2-id-1-yl)phenoxy]phenyl]-1,2-diphenyl-[1,3,2]diazaborolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 156623276 |
| Molecular Formula | C37H28BN5O |
| Molecular Weight | 569.48 g/mol |
| Exact Mass | 569.24 |
| IUPAC Name | 3-[3-[3-(3-methyl-2H-benzimidazol-3-ium-2-id-1-yl)phenoxy]phenyl]-1,2-diphenyl-[1,3,2]diazaborolo[4,5-b]pyridine |
| SMILES | C[n+]1[c-]n(-c2cccc(Oc3cccc(N4B(c5ccccc5)N(c5ccccc5)c5cccnc54)c3)c2)c2ccccc21 |
| InChI | InChI=1S/C37H28BN5O/c1-40-27-41(35-22-9-8-21-34(35)40)30-17-10-19-32(25-30)44-33-20-11-18-31(26-33)43-37-36(23-12-24-39-37)42(29-15-6-3-7-16-29)38(43)28-13-4-2-5-14-28/h2-26H,1H3 |
| InChIKey | UXQSVGZWAVPBCP-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 37.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.48 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|