C22H22N2O — CID 156623671
2,6-bis(3,5-dimethylphenyl)pyridine-3-carboxamide (PubChem CID 156623671) has the molecular formula C22H22N2O and a molecular weight of 330.43 g/mol. Its IUPAC name is 2,6-bis(3,5-dimethylphenyl)pyridine-3-carboxamide.
| Compound Name | 2,6-bis(3,5-dimethylphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 156623671 |
| Molecular Formula | C22H22N2O |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 2,6-bis(3,5-dimethylphenyl)pyridine-3-carboxamide |
| SMILES | Cc1cc(C)cc(-c2ccc(C(N)=O)c(-c3cc(C)cc(C)c3)n2)c1 |
| InChI | InChI=1S/C22H22N2O/c1-13-7-14(2)10-17(9-13)20-6-5-19(22(23)25)21(24-20)18-11-15(3)8-16(4)12-18/h5-12H,1-4H3,(H2,23,25) |
| InChIKey | WFJARWVSCCBSGB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |