About nonan-2-ylsulfanium hexafluorophosphate
nonan-2-ylsulfanium hexafluorophosphate (PubChem CID 156625464) has the molecular formula C9H21F6PS
and a molecular weight of 306.30 g/mol. Its IUPAC name is nonan-2-ylsulfanium hexafluorophosphate.
Molecular Properties
| Compound Name | nonan-2-ylsulfanium hexafluorophosphate |
| PubChem CID | 156625464 |
| Molecular Formula | C9H21F6PS |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | nonan-2-ylsulfanium hexafluorophosphate |
| SMILES | CCCCCCCC(C)[SH2+].F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C9H20S.F6P/c1-3-4-5-6-7-8-9(2)10;1-7(2,3,4,5)6/h9-10H,3-8H2,1-2H3;/q;-1/p+1 |
| InChIKey | WBHLEZHMVKOLQF-UHFFFAOYSA-O |
| XLogP | 6.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze nonan-2-ylsulfanium hexafluorophosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonan-2-ylsulfanium hexafluorophosphate?
The IUPAC name of nonan-2-ylsulfanium hexafluorophosphate (CID 156625464) is nonan-2-ylsulfanium hexafluorophosphate.
What is the SMILES notation for nonan-2-ylsulfanium hexafluorophosphate?
The canonical SMILES for nonan-2-ylsulfanium hexafluorophosphate is CCCCCCCC(C)[SH2+].F[P-](F)(F)(F)(F)F.
What is the InChIKey of nonan-2-ylsulfanium hexafluorophosphate?
The InChIKey is WBHLEZHMVKOLQF-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H20S.F6P/c1-3-4-5-6-7-8-9(2)10;1-7(2,3,4,5)6/h9-10H,3-8H2,1-2H3;/q;-1/p+1.
What are the key properties of nonan-2-ylsulfanium hexafluorophosphate?
nonan-2-ylsulfanium hexafluorophosphate has a molecular weight of 306.30 g/mol, XLogP of 6.13, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for nonan-2-ylsulfanium hexafluorophosphate is sourced from PubChem (CID 156625464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).