C11H12F3N4O3S+ — CID 156626104
2-[4-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]pyridazin-1-ium-1-yl]ethanesulfonic acid (PubChem CID 156626104) has the molecular formula C11H12F3N4O3S+ and a molecular weight of 337.30 g/mol. Its IUPAC name is 2-[4-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]pyridazin-1-ium-1-yl]ethanesulfonic acid.
| Compound Name | 2-[4-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]pyridazin-1-ium-1-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 156626104 |
| Molecular Formula | C11H12F3N4O3S+ |
| Molecular Weight | 337.30 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | 2-[4-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]pyridazin-1-ium-1-yl]ethanesulfonic acid |
| SMILES | Cn1nc(-c2cc[n+](CCS(=O)(=O)O)nc2)cc1C(F)(F)F |
| InChI | InChI=1S/C11H11F3N4O3S/c1-17-10(11(12,13)14)6-9(16-17)8-2-3-18(15-7-8)4-5-22(19,20)21/h2-3,6-7H,4-5H2,1H3/p+1 |
| InChIKey | HGNFURRGLHRGMZ-UHFFFAOYSA-O |
| XLogP | 0.68 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.30 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|