C42H80O2 — CID 156627173
(E)-2,23-dimethyl-12,13-dioctyltetracos-10-ene-3,22-dione (PubChem CID 156627173) has the molecular formula C42H80O2 and a molecular weight of 617.10 g/mol. Its IUPAC name is (E)-2,23-dimethyl-12,13-dioctyltetracos-10-ene-3,22-dione.
| Compound Name | (E)-2,23-dimethyl-12,13-dioctyltetracos-10-ene-3,22-dione |
|---|---|
| PubChem CID | 156627173 |
| Molecular Formula | C42H80O2 |
| Molecular Weight | 617.10 g/mol |
| Exact Mass | 616.62 |
| IUPAC Name | (E)-2,23-dimethyl-12,13-dioctyltetracos-10-ene-3,22-dione |
| SMILES | CCCCCCCCC(/C=C/CCCCCCC(=O)C(C)C)C(CCCCCCCC)CCCCCCCCC(=O)C(C)C |
| InChI | InChI=1S/C42H80O2/c1-7-9-11-13-19-25-31-39(33-27-21-15-17-23-29-35-41(43)37(3)4)40(32-26-20-14-12-10-8-2)34-28-22-16-18-24-30-36-42(44)38(5)6/h27,33,37-40H,7-26,28-32,34-36H2,1-6H3/b33-27+ |
| InChIKey | PAGUCALKLNVZRZ-MUGXBBEHSA-N |
| XLogP | 14.19 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.10 |
| LogP ≤ 5 | 14.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|