C26H17ClN2O2 — CID 156627187
7-(2-chloro-6-nitrophenyl)-2,3-diphenyl-1H-indole (PubChem CID 156627187) has the molecular formula C26H17ClN2O2 and a molecular weight of 424.89 g/mol. Its IUPAC name is 7-(2-chloro-6-nitrophenyl)-2,3-diphenyl-1H-indole.
| Compound Name | 7-(2-chloro-6-nitrophenyl)-2,3-diphenyl-1H-indole |
|---|---|
| PubChem CID | 156627187 |
| Molecular Formula | C26H17ClN2O2 |
| Molecular Weight | 424.89 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 7-(2-chloro-6-nitrophenyl)-2,3-diphenyl-1H-indole |
| SMILES | O=[N+]([O-])c1cccc(Cl)c1-c1cccc2c(-c3ccccc3)c(-c3ccccc3)[nH]c12 |
| InChI | InChI=1S/C26H17ClN2O2/c27-21-15-8-16-22(29(30)31)24(21)20-14-7-13-19-23(17-9-3-1-4-10-17)25(28-26(19)20)18-11-5-2-6-12-18/h1-16,28H |
| InChIKey | ZMLSTKDNFFNNSF-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 58.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.89 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|