C40H17BrN4 — CID 156630015
3-[21-bromo-14-(2,3-dicyanophenyl)-3-hexacyclo[14.7.1.02,15.04,13.06,11.020,24]tetracosa-1(24),2,4,6,8,10,12,14,16,18,20,22-dodecaenyl]benzene-1,2-dicarbonitrile (PubChem CID 156630015) has the molecular formula C40H17BrN4 and a molecular weight of 633.51 g/mol. Its IUPAC name is 3-[21-bromo-14-(2,3-dicyanophenyl)-3-hexacyclo[14.7.1.02,15.04,13.06,11.020,24]tetracosa-1(24),2,4,6,8,10,12,14,16,18,20,22-dodecaenyl]benzene-1,2-dicarbonitrile.
| Compound Name | 3-[21-bromo-14-(2,3-dicyanophenyl)-3-hexacyclo[14.7.1.02,15.04,13.06,11.020,24]tetracosa-1(24),2,4,6,8,10,12,14,16,18,20,22-dodecaenyl]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 156630015 |
| Molecular Formula | C40H17BrN4 |
| Molecular Weight | 633.51 g/mol |
| Exact Mass | 632.06 |
| IUPAC Name | 3-[21-bromo-14-(2,3-dicyanophenyl)-3-hexacyclo[14.7.1.02,15.04,13.06,11.020,24]tetracosa-1(24),2,4,6,8,10,12,14,16,18,20,22-dodecaenyl]benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1cccc(-c2c3c(c(-c4cccc(C#N)c4C#N)c4cc5ccccc5cc24)-c2ccc(Br)c4cccc-3c24)c1C#N |
| InChI | InChI=1S/C40H17BrN4/c41-35-15-14-30-36-28(35)12-5-13-29(36)39-37(26-10-3-8-24(18-42)33(26)20-44)31-16-22-6-1-2-7-23(22)17-32(31)38(40(30)39)27-11-4-9-25(19-43)34(27)21-45/h1-17H |
| InChIKey | NDFLRQLKVPYVKF-UHFFFAOYSA-N |
| XLogP | 10.38 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.51 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|