C16H22O5S — CID 156632756
4-(benzenesulfonylmethyl)-5,5-dimethyl-2-propoxyoxolan-3-one (PubChem CID 156632756) has the molecular formula C16H22O5S and a molecular weight of 326.41 g/mol. Its IUPAC name is 4-(benzenesulfonylmethyl)-5,5-dimethyl-2-propoxyoxolan-3-one.
| Compound Name | 4-(benzenesulfonylmethyl)-5,5-dimethyl-2-propoxyoxolan-3-one |
|---|---|
| PubChem CID | 156632756 |
| Molecular Formula | C16H22O5S |
| Molecular Weight | 326.41 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 4-(benzenesulfonylmethyl)-5,5-dimethyl-2-propoxyoxolan-3-one |
| SMILES | CCCOC1OC(C)(C)C(CS(=O)(=O)c2ccccc2)C1=O |
| InChI | InChI=1S/C16H22O5S/c1-4-10-20-15-14(17)13(16(2,3)21-15)11-22(18,19)12-8-6-5-7-9-12/h5-9,13,15H,4,10-11H2,1-3H3 |
| InChIKey | RPVASXILHFMJOG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |