C14H18O5S — CID 14682673
4-(benzenesulfonyl)-1-(1,3-dioxolan-2-yl)pentan-2-one (PubChem CID 14682673) has the molecular formula C14H18O5S and a molecular weight of 298.36 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-1-(1,3-dioxolan-2-yl)pentan-2-one.
| Compound Name | 4-(benzenesulfonyl)-1-(1,3-dioxolan-2-yl)pentan-2-one |
|---|---|
| PubChem CID | 14682673 |
| Molecular Formula | C14H18O5S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 4-(benzenesulfonyl)-1-(1,3-dioxolan-2-yl)pentan-2-one |
| SMILES | CC(CC(=O)CC1OCCO1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H18O5S/c1-11(9-12(15)10-14-18-7-8-19-14)20(16,17)13-5-3-2-4-6-13/h2-6,11,14H,7-10H2,1H3 |
| InChIKey | SGJFVPDHADYXKK-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |