C13H22O4 — CID 15663383
1-(6,6,8-trimethyl-1,4-dioxaspiro[4.5]dec-7-en-7-yl)ethane-1,2-diol (PubChem CID 15663383) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is 1-(6,6,8-trimethyl-1,4-dioxaspiro[4.5]dec-7-en-7-yl)ethane-1,2-diol.
| Compound Name | 1-(6,6,8-trimethyl-1,4-dioxaspiro[4.5]dec-7-en-7-yl)ethane-1,2-diol |
|---|---|
| PubChem CID | 15663383 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 1-(6,6,8-trimethyl-1,4-dioxaspiro[4.5]dec-7-en-7-yl)ethane-1,2-diol |
| SMILES | CC1=C(C(O)CO)C(C)(C)C2(CC1)OCCO2 |
| InChI | InChI=1S/C13H22O4/c1-9-4-5-13(16-6-7-17-13)12(2,3)11(9)10(15)8-14/h10,14-15H,4-8H2,1-3H3 |
| InChIKey | WXABDYIVJXRDOC-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|