C15H24O3 — CID 590624
6',6'-dimethylspiro[1,3-dioxolane-2,8'-2,3,4,5,7,9-hexahydro-1H-cyclopenta[8]annulene]-4'-ol (PubChem CID 590624) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is 6',6'-dimethylspiro[1,3-dioxolane-2,8'-2,3,4,5,7,9-hexahydro-1H-cyclopenta[8]annulene]-4'-ol.
| Compound Name | 6',6'-dimethylspiro[1,3-dioxolane-2,8'-2,3,4,5,7,9-hexahydro-1H-cyclopenta[8]annulene]-4'-ol |
|---|---|
| PubChem CID | 590624 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 6',6'-dimethylspiro[1,3-dioxolane-2,8'-2,3,4,5,7,9-hexahydro-1H-cyclopenta[8]annulene]-4'-ol |
| SMILES | CC1(C)CC(O)C2=C(CCC2)CC2(C1)OCCO2 |
| InChI | InChI=1S/C15H24O3/c1-14(2)9-13(16)12-5-3-4-11(12)8-15(10-14)17-6-7-18-15/h13,16H,3-10H2,1-2H3 |
| InChIKey | HCAIXYPBMNAOCA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|