C13H21NO7S — CID 156636245
1-O-tert-butyl 3-O-ethyl 4-methylsulfonyloxy-2,3-dihydropyrrole-1,3-dicarboxylate (PubChem CID 156636245) has the molecular formula C13H21NO7S and a molecular weight of 335.38 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-ethyl 4-methylsulfonyloxy-2,3-dihydropyrrole-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-ethyl 4-methylsulfonyloxy-2,3-dihydropyrrole-1,3-dicarboxylate |
|---|---|
| PubChem CID | 156636245 |
| Molecular Formula | C13H21NO7S |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 1-O-tert-butyl 3-O-ethyl 4-methylsulfonyloxy-2,3-dihydropyrrole-1,3-dicarboxylate |
| SMILES | CCOC(=O)C1CN(C(=O)OC(C)(C)C)C=C1OS(C)(=O)=O |
| InChI | InChI=1S/C13H21NO7S/c1-6-19-11(15)9-7-14(12(16)20-13(2,3)4)8-10(9)21-22(5,17)18/h8-9H,6-7H2,1-5H3 |
| InChIKey | LZSUMXQWVLVBGV-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|